C11H13BrO2S — CID 169456373
3-(4-bromo-3,5-dimethoxyphenyl)prop-2-ene-1-thiol (PubChem CID 169456373) has the molecular formula C11H13BrO2S and a molecular weight of 289.19 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethoxyphenyl)prop-2-ene-1-thiol.
| Compound Name | 3-(4-bromo-3,5-dimethoxyphenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169456373 |
| Molecular Formula | C11H13BrO2S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 3-(4-bromo-3,5-dimethoxyphenyl)prop-2-ene-1-thiol |
| SMILES | COc1cc(C=CCS)cc(OC)c1Br |
| InChI | InChI=1S/C11H13BrO2S/c1-13-9-6-8(4-3-5-15)7-10(14-2)11(9)12/h3-4,6-7,15H,5H2,1-2H3 |
| InChIKey | QKVUBXJUBFPUOG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|