C10H12BrNO2 — CID 143939244
1-(4-bromo-3,5-dimethoxyphenyl)-N-methylmethanimine (PubChem CID 143939244) has the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethoxyphenyl)-N-methylmethanimine.
| Compound Name | 1-(4-bromo-3,5-dimethoxyphenyl)-N-methylmethanimine |
|---|---|
| PubChem CID | 143939244 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 1-(4-bromo-3,5-dimethoxyphenyl)-N-methylmethanimine |
| SMILES | C/N=C/c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C10H12BrNO2/c1-12-6-7-4-8(13-2)10(11)9(5-7)14-3/h4-6H,1-3H3/b12-6+ |
| InChIKey | GKBLOLJVGZEEJS-WUXMJOGZSA-N |
| XLogP | 2.52 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|