C9H7Br2NO — CID 169482889
3-(3,5-dibromophenyl)prop-2-enamide (PubChem CID 169482889) has the molecular formula C9H7Br2NO and a molecular weight of 304.97 g/mol. Its IUPAC name is 3-(3,5-dibromophenyl)prop-2-enamide.
| Compound Name | 3-(3,5-dibromophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 169482889 |
| Molecular Formula | C9H7Br2NO |
| Molecular Weight | 304.97 g/mol |
| Exact Mass | 302.89 |
| IUPAC Name | 3-(3,5-dibromophenyl)prop-2-enamide |
| SMILES | NC(=O)C=Cc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C9H7Br2NO/c10-7-3-6(1-2-9(12)13)4-8(11)5-7/h1-5H,(H2,12,13) |
| InChIKey | SKTSHDXKJNHDPQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.97 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|