C15H9Br3O — CID 123139887
1-(3-bromophenyl)-3-(3,5-dibromophenyl)prop-2-en-1-one (PubChem CID 123139887) has the molecular formula C15H9Br3O and a molecular weight of 444.95 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(3,5-dibromophenyl)prop-2-en-1-one.
| Compound Name | 1-(3-bromophenyl)-3-(3,5-dibromophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123139887 |
| Molecular Formula | C15H9Br3O |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 441.82 |
| IUPAC Name | 1-(3-bromophenyl)-3-(3,5-dibromophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(Br)cc(Br)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H9Br3O/c16-12-3-1-2-11(8-12)15(19)5-4-10-6-13(17)9-14(18)7-10/h1-9H |
| InChIKey | MQRJVHPSIFXGMU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|