C11H7BrCl2O — CID 71346907
1-(3-bromophenyl)-5,5-dichloropenta-2,4-dien-1-one (PubChem CID 71346907) has the molecular formula C11H7BrCl2O and a molecular weight of 305.99 g/mol. Its IUPAC name is 1-(3-bromophenyl)-5,5-dichloropenta-2,4-dien-1-one.
| Compound Name | 1-(3-bromophenyl)-5,5-dichloropenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 71346907 |
| Molecular Formula | C11H7BrCl2O |
| Molecular Weight | 305.99 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | 1-(3-bromophenyl)-5,5-dichloropenta-2,4-dien-1-one |
| SMILES | O=C(C=CC=C(Cl)Cl)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H7BrCl2O/c12-9-4-1-3-8(7-9)10(15)5-2-6-11(13)14/h1-7H |
| InChIKey | DLJYAEISYSWWCJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|