C18H15BrO — CID 139259982
(2E,4Z)-1-(3-bromophenyl)-6-phenylhexa-2,4-dien-1-one (PubChem CID 139259982) has the molecular formula C18H15BrO and a molecular weight of 327.22 g/mol. Its IUPAC name is (2E,4Z)-1-(3-bromophenyl)-6-phenylhexa-2,4-dien-1-one.
| Compound Name | (2E,4Z)-1-(3-bromophenyl)-6-phenylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 139259982 |
| Molecular Formula | C18H15BrO |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | (2E,4Z)-1-(3-bromophenyl)-6-phenylhexa-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C\Cc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H15BrO/c19-17-12-7-11-16(14-17)18(20)13-6-2-5-10-15-8-3-1-4-9-15/h1-9,11-14H,10H2/b5-2-,13-6+ |
| InChIKey | KPHLRPRAYJNMHH-RIKACAKKSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|