About 6-phenylhexa-2,4-dienylbenzene;titanium
6-phenylhexa-2,4-dienylbenzene;titanium (PubChem CID 161467723) has the molecular formula C18H18Ti
and a molecular weight of 282.21 g/mol. Its IUPAC name is 6-phenylhexa-2,4-dienylbenzene;titanium.
Molecular Properties
| Compound Name | 6-phenylhexa-2,4-dienylbenzene;titanium |
| PubChem CID | 161467723 |
| Molecular Formula | C18H18Ti |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 6-phenylhexa-2,4-dienylbenzene;titanium |
| SMILES | C(C=CCc1ccccc1)=CCc1ccccc1.[Ti] |
| InChI | InChI=1S/C18H18.Ti/c1(5-11-17-13-7-3-8-14-17)2-6-12-18-15-9-4-10-16-18;/h1-10,13-16H,11-12H2; |
| InChIKey | WCQXHHJXHBPIMV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-phenylhexa-2,4-dienylbenzene;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylhexa-2,4-dienylbenzene;titanium?
The IUPAC name of 6-phenylhexa-2,4-dienylbenzene;titanium (CID 161467723) is 6-phenylhexa-2,4-dienylbenzene;titanium.
What is the SMILES notation for 6-phenylhexa-2,4-dienylbenzene;titanium?
The canonical SMILES for 6-phenylhexa-2,4-dienylbenzene;titanium is C(C=CCc1ccccc1)=CCc1ccccc1.[Ti].
What is the InChIKey of 6-phenylhexa-2,4-dienylbenzene;titanium?
The InChIKey is WCQXHHJXHBPIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18.Ti/c1(5-11-17-13-7-3-8-14-17)2-6-12-18-15-9-4-10-16-18;/h1-10,13-16H,11-12H2;.
What are the key properties of 6-phenylhexa-2,4-dienylbenzene;titanium?
6-phenylhexa-2,4-dienylbenzene;titanium has a molecular weight of 282.21 g/mol, XLogP of 4.58, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylhexa-2,4-dienylbenzene;titanium is sourced from PubChem (CID 161467723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).