C26H24Br2O — CID 145297593
(E)-3-(3,5-dibromophenyl)-1-(4-phenylphenyl)prop-2-en-1-one;(Z)-pent-2-ene (PubChem CID 145297593) has the molecular formula C26H24Br2O and a molecular weight of 512.29 g/mol. Its IUPAC name is (E)-3-(3,5-dibromophenyl)-1-(4-phenylphenyl)prop-2-en-1-one;(Z)-pent-2-ene.
| Compound Name | (E)-3-(3,5-dibromophenyl)-1-(4-phenylphenyl)prop-2-en-1-one;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 145297593 |
| Molecular Formula | C26H24Br2O |
| Molecular Weight | 512.29 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | (E)-3-(3,5-dibromophenyl)-1-(4-phenylphenyl)prop-2-en-1-one;(Z)-pent-2-ene |
| SMILES | C/C=C\CC.O=C(/C=C/c1cc(Br)cc(Br)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H14Br2O.C5H10/c22-19-12-15(13-20(23)14-19)6-11-21(24)18-9-7-17(8-10-18)16-4-2-1-3-5-16;1-3-5-4-2/h1-14H;3,5H,4H2,1-2H3/b11-6+;5-3- |
| InChIKey | KESPQMGDJPNFGD-QXYWGVEISA-N |
| XLogP | 8.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.29 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|