C42H30Br4O3 — CID 160690229
3,5-dibromobenzaldehyde;(E)-3-(3,5-dibromophenyl)-1-(4-phenylphenyl)prop-2-en-1-one;1-(4-phenylphenyl)ethanone (PubChem CID 160690229) has the molecular formula C42H30Br4O3 and a molecular weight of 902.32 g/mol. Its IUPAC name is 3,5-dibromobenzaldehyde;(E)-3-(3,5-dibromophenyl)-1-(4-phenylphenyl)prop-2-en-1-one;1-(4-phenylphenyl)ethanone.
| Compound Name | 3,5-dibromobenzaldehyde;(E)-3-(3,5-dibromophenyl)-1-(4-phenylphenyl)prop-2-en-1-one;1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 160690229 |
| Molecular Formula | C42H30Br4O3 |
| Molecular Weight | 902.32 g/mol |
| Exact Mass | 897.89 |
| IUPAC Name | 3,5-dibromobenzaldehyde;(E)-3-(3,5-dibromophenyl)-1-(4-phenylphenyl)prop-2-en-1-one;1-(4-phenylphenyl)ethanone |
| SMILES | CC(=O)c1ccc(-c2ccccc2)cc1.O=C(/C=C/c1cc(Br)cc(Br)c1)c1ccc(-c2ccccc2)cc1.O=Cc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C21H14Br2O.C14H12O.C7H4Br2O/c22-19-12-15(13-20(23)14-19)6-11-21(24)18-9-7-17(8-10-18)16-4-2-1-3-5-16;1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13;8-6-1-5(4-10)2-7(9)3-6/h1-14H;2-10H,1H3;1-4H/b11-6+;; |
| InChIKey | RPHRXXGIOCABTI-QVLKBJGCSA-N |
| XLogP | 13.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.32 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|