About 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone
4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone (PubChem CID 162251763) has the molecular formula C30H24Br2O3
and a molecular weight of 592.33 g/mol. Its IUPAC name is 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone.
Molecular Properties
| Compound Name | 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone |
| PubChem CID | 162251763 |
| Molecular Formula | C30H24Br2O3 |
| Molecular Weight | 592.33 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.O=C(/C=C/c1ccc(Br)cc1)c1ccccc1.O=Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H11BrO.C8H8O.C7H5BrO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13;1-7(9)8-5-3-2-4-6-8;8-7-3-1-6(5-9)2-4-7/h1-11H;2-6H,1H3;1-5H/b11-8+;; |
| InChIKey | ZYBUJPMXAOJFNA-OHENRDTHSA-N |
| XLogP | 8.50 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.33 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone?
The IUPAC name of 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone (CID 162251763) is 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone.
What is the SMILES notation for 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone?
The canonical SMILES for 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone is CC(=O)c1ccccc1.O=C(/C=C/c1ccc(Br)cc1)c1ccccc1.O=Cc1ccc(Br)cc1.
What is the InChIKey of 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone?
The InChIKey is ZYBUJPMXAOJFNA-OHENRDTHSA-N. The full InChI is InChI=1S/C15H11BrO.C8H8O.C7H5BrO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13;1-7(9)8-5-3-2-4-6-8;8-7-3-1-6(5-9)2-4-7/h1-11H;2-6H,1H3;1-5H/b11-8+;;.
What are the key properties of 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone?
4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone has a molecular weight of 592.33 g/mol, XLogP of 8.50, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzaldehyde;(E)-3-(4-bromophenyl)-1-phenylprop-2-en-1-one;1-phenylethanone is sourced from PubChem (CID 162251763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).