About (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide
(Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide (PubChem CID 55267922) has the molecular formula C9H7F2NO2
and a molecular weight of 199.16 g/mol. Its IUPAC name is (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide.
Molecular Properties
| Compound Name | (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide |
| PubChem CID | 55267922 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide |
| SMILES | NC(=O)/C=C\c1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C9H7F2NO2/c10-6-3-5(1-2-8(12)13)4-7(11)9(6)14/h1-4,14H,(H2,12,13)/b2-1- |
| InChIKey | PQQYMGGEDDXOOL-UPHRSURJSA-N |
| XLogP | 1.17 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide?
The IUPAC name of (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide (CID 55267922) is (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide.
What is the SMILES notation for (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide?
The canonical SMILES for (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide is NC(=O)/C=C\c1cc(F)c(O)c(F)c1.
What is the InChIKey of (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide?
The InChIKey is PQQYMGGEDDXOOL-UPHRSURJSA-N. The full InChI is InChI=1S/C9H7F2NO2/c10-6-3-5(1-2-8(12)13)4-7(11)9(6)14/h1-4,14H,(H2,12,13)/b2-1-.
What are the key properties of (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide?
(Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide has a molecular weight of 199.16 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(3,5-difluoro-4-hydroxyphenyl)prop-2-enamide is sourced from PubChem (CID 55267922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).