C9H7Br2NO2 — CID 131238888
(E)-3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enamide (PubChem CID 131238888) has the molecular formula C9H7Br2NO2 and a molecular weight of 320.97 g/mol. Its IUPAC name is (E)-3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 131238888 |
| Molecular Formula | C9H7Br2NO2 |
| Molecular Weight | 320.97 g/mol |
| Exact Mass | 318.88 |
| IUPAC Name | (E)-3-(3,5-dibromo-2-hydroxyphenyl)prop-2-enamide |
| SMILES | NC(=O)/C=C/c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C9H7Br2NO2/c10-6-3-5(1-2-8(12)13)9(14)7(11)4-6/h1-4,14H,(H2,12,13)/b2-1+ |
| InChIKey | FZBYPAJXNZYEGC-OWOJBTEDSA-N |
| XLogP | 2.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.97 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|