C9H6Br3NO2 — CID 131551507
(E)-3-(3,4,5-tribromo-2-hydroxyphenyl)prop-2-enamide (PubChem CID 131551507) has the molecular formula C9H6Br3NO2 and a molecular weight of 399.86 g/mol. Its IUPAC name is (E)-3-(3,4,5-tribromo-2-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4,5-tribromo-2-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 131551507 |
| Molecular Formula | C9H6Br3NO2 |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 396.79 |
| IUPAC Name | (E)-3-(3,4,5-tribromo-2-hydroxyphenyl)prop-2-enamide |
| SMILES | NC(=O)/C=C/c1cc(Br)c(Br)c(Br)c1O |
| InChI | InChI=1S/C9H6Br3NO2/c10-5-3-4(1-2-6(13)14)9(15)8(12)7(5)11/h1-3,15H,(H2,13,14)/b2-1+ |
| InChIKey | HBQRGXOYVUVOOO-OWOJBTEDSA-N |
| XLogP | 3.18 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|