C10H10BrNO3 — CID 169482902
3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enamide (PubChem CID 169482902) has the molecular formula C10H10BrNO3 and a molecular weight of 272.10 g/mol. Its IUPAC name is 3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enamide.
| Compound Name | 3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 169482902 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | 3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(Br)c(C=CC(N)=O)cc1O |
| InChI | InChI=1S/C10H10BrNO3/c1-15-9-5-7(11)6(4-8(9)13)2-3-10(12)14/h2-5,13H,1H3,(H2,12,14) |
| InChIKey | NPELYZSJSRCVIU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|