C18H16BrClO5 — CID 76871272
3-(2-bromo-4-hydroxy-5-methoxyphenyl)-1-(5-chloro-2,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 76871272) has the molecular formula C18H16BrClO5 and a molecular weight of 427.68 g/mol. Its IUPAC name is 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-1-(5-chloro-2,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-1-(5-chloro-2,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 76871272 |
| Molecular Formula | C18H16BrClO5 |
| Molecular Weight | 427.68 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-1-(5-chloro-2,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2cc(Cl)c(OC)cc2OC)c(Br)cc1O |
| InChI | InChI=1S/C18H16BrClO5/c1-23-16-9-17(24-2)13(20)7-11(16)14(21)5-4-10-6-18(25-3)15(22)8-12(10)19/h4-9,22H,1-3H3 |
| InChIKey | ZZILROXZPCTKDD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.68 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|