C20H20BrNO4 — CID 76871231
3-(2-bromo-4-hydroxy-5-methoxyphenyl)-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 76871231) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 76871231 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc(N3CCOCC3)cc2)c(Br)cc1O |
| InChI | InChI=1S/C20H20BrNO4/c1-25-20-12-15(17(21)13-19(20)24)4-7-18(23)14-2-5-16(6-3-14)22-8-10-26-11-9-22/h2-7,12-13,24H,8-11H2,1H3 |
| InChIKey | SPEQPHNNDNZIHO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|