C22H25NO3 — CID 51424205
(E)-1-(4-morpholin-4-ylphenyl)-3-(2-propan-2-yloxyphenyl)prop-2-en-1-one (PubChem CID 51424205) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (E)-1-(4-morpholin-4-ylphenyl)-3-(2-propan-2-yloxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-morpholin-4-ylphenyl)-3-(2-propan-2-yloxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51424205 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (E)-1-(4-morpholin-4-ylphenyl)-3-(2-propan-2-yloxyphenyl)prop-2-en-1-one |
| SMILES | CC(C)Oc1ccccc1/C=C/C(=O)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H25NO3/c1-17(2)26-22-6-4-3-5-19(22)9-12-21(24)18-7-10-20(11-8-18)23-13-15-25-16-14-23/h3-12,17H,13-16H2,1-2H3/b12-9+ |
| InChIKey | AXUQUICTTWBWTP-FMIVXFBMSA-N |
| XLogP | 4.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|