C27H25Cl2NO4 — CID 19543164
(E)-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 19543164) has the molecular formula C27H25Cl2NO4 and a molecular weight of 498.41 g/mol. Its IUPAC name is (E)-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19543164 |
| Molecular Formula | C27H25Cl2NO4 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | (E)-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc(N3CCOCC3)cc2)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H25Cl2NO4/c1-32-26-4-2-3-21(27(26)34-18-19-5-11-23(28)24(29)17-19)8-12-25(31)20-6-9-22(10-7-20)30-13-15-33-16-14-30/h2-12,17H,13-16,18H2,1H3/b12-8+ |
| InChIKey | NZIISBUOIOPVSB-XYOKQWHBSA-N |
| XLogP | 6.31 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|