C23H25NO6 — CID 8814776
(E)-3-(2,3-dimethoxyphenyl)-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-en-1-one (PubChem CID 8814776) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is (E)-3-(2,3-dimethoxyphenyl)-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dimethoxyphenyl)-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 8814776 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (E)-3-(2,3-dimethoxyphenyl)-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)c2ccc(OCC(=O)N3CCOCC3)cc2)c1OC |
| InChI | InChI=1S/C23H25NO6/c1-27-21-5-3-4-18(23(21)28-2)8-11-20(25)17-6-9-19(10-7-17)30-16-22(26)24-12-14-29-15-13-24/h3-11H,12-16H2,1-2H3/b11-8+ |
| InChIKey | RBIGOTIPINNSGW-DHZHZOJOSA-N |
| XLogP | 2.84 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|