C24H20Cl2O4 — CID 19558757
(E)-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 19558757) has the molecular formula C24H20Cl2O4 and a molecular weight of 443.33 g/mol. Its IUPAC name is (E)-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19558757 |
| Molecular Formula | C24H20Cl2O4 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | (E)-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-1-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cccc(OC)c2OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H20Cl2O4/c1-28-19-10-7-17(8-11-19)22(27)13-9-18-4-3-5-23(29-2)24(18)30-15-16-6-12-20(25)21(26)14-16/h3-14H,15H2,1-2H3/b13-9+ |
| InChIKey | KDVOAVMSTPLGII-UKTHLTGXSA-N |
| XLogP | 6.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|