C20H18Cl2O3 — CID 19558963
(E)-1-cyclopropyl-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-en-1-one (PubChem CID 19558963) has the molecular formula C20H18Cl2O3 and a molecular weight of 377.27 g/mol. Its IUPAC name is (E)-1-cyclopropyl-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-cyclopropyl-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19558963 |
| Molecular Formula | C20H18Cl2O3 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (E)-1-cyclopropyl-3-[2-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)C2CC2)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2O3/c1-24-19-4-2-3-15(8-10-18(23)14-6-7-14)20(19)25-12-13-5-9-16(21)17(22)11-13/h2-5,8-11,14H,6-7,12H2,1H3/b10-8+ |
| InChIKey | ZQGJJODGHCKBET-CSKARUKUSA-N |
| XLogP | 5.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|