C13H11ClN2O3S — CID 98572725
(Z)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(thiadiazol-4-yl)prop-2-en-1-one (PubChem CID 98572725) has the molecular formula C13H11ClN2O3S and a molecular weight of 310.76 g/mol. Its IUPAC name is (Z)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(thiadiazol-4-yl)prop-2-en-1-one.
| Compound Name | (Z)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(thiadiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 98572725 |
| Molecular Formula | C13H11ClN2O3S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (Z)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(thiadiazol-4-yl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(C(=O)/C=C\c2csnn2)cc1Cl |
| InChI | InChI=1S/C13H11ClN2O3S/c1-18-12-6-13(19-2)10(14)5-9(12)11(17)4-3-8-7-20-16-15-8/h3-7H,1-2H3/b4-3- |
| InChIKey | WGBRDGHDDNQCNU-ARJAWSKDSA-N |
| XLogP | 3.10 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|