C13H13ClO6 — CID 53395920
methyl 4-(5-chloro-2,4-dimethoxyphenyl)-4-hydroxy-2-oxobut-3-enoate (PubChem CID 53395920) has the molecular formula C13H13ClO6 and a molecular weight of 300.69 g/mol. Its IUPAC name is methyl 4-(5-chloro-2,4-dimethoxyphenyl)-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | methyl 4-(5-chloro-2,4-dimethoxyphenyl)-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 53395920 |
| Molecular Formula | C13H13ClO6 |
| Molecular Weight | 300.69 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | methyl 4-(5-chloro-2,4-dimethoxyphenyl)-4-hydroxy-2-oxobut-3-enoate |
| SMILES | COC(=O)C(=O)C=C(O)c1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C13H13ClO6/c1-18-11-6-12(19-2)8(14)4-7(11)9(15)5-10(16)13(17)20-3/h4-6,15H,1-3H3 |
| InChIKey | CXBOGRVWUQKKAF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.69 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|