C13H13ClO4 — CID 82550903
methyl (Z)-4-(4-chloro-2,5-dimethylphenyl)-4-hydroxy-2-oxobut-3-enoate (PubChem CID 82550903) has the molecular formula C13H13ClO4 and a molecular weight of 268.70 g/mol. Its IUPAC name is methyl (Z)-4-(4-chloro-2,5-dimethylphenyl)-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | methyl (Z)-4-(4-chloro-2,5-dimethylphenyl)-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 82550903 |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | methyl (Z)-4-(4-chloro-2,5-dimethylphenyl)-4-hydroxy-2-oxobut-3-enoate |
| SMILES | COC(=O)C(=O)/C=C(\O)c1cc(C)c(Cl)cc1C |
| InChI | InChI=1S/C13H13ClO4/c1-7-5-10(14)8(2)4-9(7)11(15)6-12(16)13(17)18-3/h4-6,15H,1-3H3/b11-6- |
| InChIKey | DKAPJCVCJLQILC-WDZFZDKYSA-N |
| XLogP | 2.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|