C11H7Cl3O4 — CID 82550960
methyl (Z)-4-hydroxy-2-oxo-4-(2,3,4-trichlorophenyl)but-3-enoate (PubChem CID 82550960) has the molecular formula C11H7Cl3O4 and a molecular weight of 309.53 g/mol. Its IUPAC name is methyl (Z)-4-hydroxy-2-oxo-4-(2,3,4-trichlorophenyl)but-3-enoate.
| Compound Name | methyl (Z)-4-hydroxy-2-oxo-4-(2,3,4-trichlorophenyl)but-3-enoate |
|---|---|
| PubChem CID | 82550960 |
| Molecular Formula | C11H7Cl3O4 |
| Molecular Weight | 309.53 g/mol |
| Exact Mass | 307.94 |
| IUPAC Name | methyl (Z)-4-hydroxy-2-oxo-4-(2,3,4-trichlorophenyl)but-3-enoate |
| SMILES | COC(=O)C(=O)/C=C(\O)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl3O4/c1-18-11(17)8(16)4-7(15)5-2-3-6(12)10(14)9(5)13/h2-4,15H,1H3/b7-4- |
| InChIKey | GKVZOQBOBMWMBJ-DAXSKMNVSA-N |
| XLogP | 3.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|