C19H18ClNO7 — CID 30884440
(E)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-en-1-one (PubChem CID 30884440) has the molecular formula C19H18ClNO7 and a molecular weight of 407.81 g/mol. Its IUPAC name is (E)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 30884440 |
| Molecular Formula | C19H18ClNO7 |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (E)-1-(5-chloro-2,4-dimethoxyphenyl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(C(=O)/C=C/c2cc(OC)c(OC)cc2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H18ClNO7/c1-25-16-10-17(26-2)13(20)8-12(16)15(22)6-5-11-7-18(27-3)19(28-4)9-14(11)21(23)24/h5-10H,1-4H3/b6-5+ |
| InChIKey | VNKOYBVWIORFLN-AATRIKPKSA-N |
| XLogP | 4.18 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|