C61H111NO16 — CID 173277671
pentakis(decanoic acid);(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoic acid (PubChem CID 173277671) has the molecular formula C61H111NO16 and a molecular weight of 1114.55 g/mol. Its IUPAC name is pentakis(decanoic acid);(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoic acid.
| Compound Name | pentakis(decanoic acid);(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 173277671 |
| Molecular Formula | C61H111NO16 |
| Molecular Weight | 1114.55 g/mol |
| Exact Mass | 1113.79 |
| IUPAC Name | pentakis(decanoic acid);(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoic acid |
| SMILES | CCCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.CCCCCCCCCC(=O)O.COc1cc(/C=C/C(=O)O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C11H11NO6.5C10H20O2/c1-17-9-5-7(3-4-11(13)14)8(12(15)16)6-10(9)18-2;5*1-2-3-4-5-6-7-8-9-10(11)12/h3-6H,1-2H3,(H,13,14);5*2-9H2,1H3,(H,11,12)/b4-3+;;;;; |
| InChIKey | ZDHZGMRGYBIGFG-XIOYJQOGSA-N |
| XLogP | 17.77 |
| TPSA | 285.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1114.55 |
| LogP ≤ 5 | 17.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|