C16H21NO7 — CID 126622319
ethyl 6-(4-formyl-2-methoxy-5-nitrophenoxy)hexanoate (PubChem CID 126622319) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is ethyl 6-(4-formyl-2-methoxy-5-nitrophenoxy)hexanoate.
| Compound Name | ethyl 6-(4-formyl-2-methoxy-5-nitrophenoxy)hexanoate |
|---|---|
| PubChem CID | 126622319 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | ethyl 6-(4-formyl-2-methoxy-5-nitrophenoxy)hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cc([N+](=O)[O-])c(C=O)cc1OC |
| InChI | InChI=1S/C16H21NO7/c1-3-23-16(19)7-5-4-6-8-24-15-10-13(17(20)21)12(11-18)9-14(15)22-2/h9-11H,3-8H2,1-2H3 |
| InChIKey | ODNPTSRKHQQDAZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|