C27H26N2O10 — CID 90421178
4-[5-(4-formyl-5-nitro-2-phenylmethoxyphenoxy)pentoxy]-5-methoxy-2-nitrobenzaldehyde (PubChem CID 90421178) has the molecular formula C27H26N2O10 and a molecular weight of 538.51 g/mol. Its IUPAC name is 4-[5-(4-formyl-5-nitro-2-phenylmethoxyphenoxy)pentoxy]-5-methoxy-2-nitrobenzaldehyde.
| Compound Name | 4-[5-(4-formyl-5-nitro-2-phenylmethoxyphenoxy)pentoxy]-5-methoxy-2-nitrobenzaldehyde |
|---|---|
| PubChem CID | 90421178 |
| Molecular Formula | C27H26N2O10 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 4-[5-(4-formyl-5-nitro-2-phenylmethoxyphenoxy)pentoxy]-5-methoxy-2-nitrobenzaldehyde |
| SMILES | COc1cc(C=O)c([N+](=O)[O-])cc1OCCCCCOc1cc([N+](=O)[O-])c(C=O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H26N2O10/c1-36-24-12-20(16-30)22(28(32)33)14-26(24)37-10-6-3-7-11-38-27-15-23(29(34)35)21(17-31)13-25(27)39-18-19-8-4-2-5-9-19/h2,4-5,8-9,12-17H,3,6-7,10-11,18H2,1H3 |
| InChIKey | WCLXKXSZVWNHEC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|