C15H12BrClO3S — CID 8856536
(E)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(5-chlorothiophen-2-yl)prop-2-en-1-one (PubChem CID 8856536) has the molecular formula C15H12BrClO3S and a molecular weight of 387.68 g/mol. Its IUPAC name is (E)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(5-chlorothiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(5-chlorothiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8856536 |
| Molecular Formula | C15H12BrClO3S |
| Molecular Weight | 387.68 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-1-(5-chlorothiophen-2-yl)prop-2-en-1-one |
| SMILES | COc1cc(Br)c(/C=C/C(=O)c2ccc(Cl)s2)cc1OC |
| InChI | InChI=1S/C15H12BrClO3S/c1-19-12-7-9(10(16)8-13(12)20-2)3-4-11(18)14-5-6-15(17)21-14/h3-8H,1-2H3/b4-3+ |
| InChIKey | REKCDBOHHTXXCG-ONEGZZNKSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.68 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|