C15H13ClOS — CID 7946945
(E)-1-(5-chlorothiophen-2-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one (PubChem CID 7946945) has the molecular formula C15H13ClOS and a molecular weight of 276.79 g/mol. Its IUPAC name is (E)-1-(5-chlorothiophen-2-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-chlorothiophen-2-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7946945 |
| Molecular Formula | C15H13ClOS |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (E)-1-(5-chlorothiophen-2-yl)-3-(2,4-dimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)c2ccc(Cl)s2)c(C)c1 |
| InChI | InChI=1S/C15H13ClOS/c1-10-3-4-12(11(2)9-10)5-6-13(17)14-7-8-15(16)18-14/h3-9H,1-2H3/b6-5+ |
| InChIKey | WLADGAXMPZCBSS-AATRIKPKSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|