C20H14Cl2O4S2 — CID 176768233
1-(5-chlorothiophen-2-yl)-3-[4-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-2,5-dihydroxyphenyl]propan-1-one (PubChem CID 176768233) has the molecular formula C20H14Cl2O4S2 and a molecular weight of 453.37 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-3-[4-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-2,5-dihydroxyphenyl]propan-1-one.
| Compound Name | 1-(5-chlorothiophen-2-yl)-3-[4-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-2,5-dihydroxyphenyl]propan-1-one |
|---|---|
| PubChem CID | 176768233 |
| Molecular Formula | C20H14Cl2O4S2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-3-[4-[(E)-3-(5-chlorothiophen-2-yl)-3-oxoprop-1-enyl]-2,5-dihydroxyphenyl]propan-1-one |
| SMILES | O=C(/C=C/c1cc(O)c(CCC(=O)c2ccc(Cl)s2)cc1O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H14Cl2O4S2/c21-19-7-5-17(27-19)13(23)3-1-11-9-16(26)12(10-15(11)25)2-4-14(24)18-6-8-20(22)28-18/h1,3,5-10,25-26H,2,4H2/b3-1+ |
| InChIKey | SXKJBBIOFTWOIH-HNQUOIGGSA-N |
| XLogP | 6.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|