C11H6Cl2OS2 — CID 92532745
(Z)-1,3-bis(5-chlorothiophen-2-yl)prop-2-en-1-one (PubChem CID 92532745) has the molecular formula C11H6Cl2OS2 and a molecular weight of 289.21 g/mol. Its IUPAC name is (Z)-1,3-bis(5-chlorothiophen-2-yl)prop-2-en-1-one.
| Compound Name | (Z)-1,3-bis(5-chlorothiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 92532745 |
| Molecular Formula | C11H6Cl2OS2 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 287.92 |
| IUPAC Name | (Z)-1,3-bis(5-chlorothiophen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C\c1ccc(Cl)s1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H6Cl2OS2/c12-10-5-2-7(15-10)1-3-8(14)9-4-6-11(13)16-9/h1-6H/b3-1- |
| InChIKey | SWOYNTHAVGKVJZ-IWQZZHSRSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|