C14H9ClO3S — CID 8895066
(E)-3-(1,3-benzodioxol-5-yl)-1-(5-chlorothiophen-2-yl)prop-2-en-1-one (PubChem CID 8895066) has the molecular formula C14H9ClO3S and a molecular weight of 292.74 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-(5-chlorothiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(5-chlorothiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8895066 |
| Molecular Formula | C14H9ClO3S |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(5-chlorothiophen-2-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H9ClO3S/c15-14-6-5-13(19-14)10(16)3-1-9-2-4-11-12(7-9)18-8-17-11/h1-7H,8H2/b3-1+ |
| InChIKey | BQSJOQFSBOPBRZ-HNQUOIGGSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|