C14H9Cl2NO5S2 — CID 75363628
(E)-3-(1,3-benzodioxol-5-yl)-N-(2,5-dichlorothiophen-3-yl)sulfonylprop-2-enamide (PubChem CID 75363628) has the molecular formula C14H9Cl2NO5S2 and a molecular weight of 406.27 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(2,5-dichlorothiophen-3-yl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(2,5-dichlorothiophen-3-yl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 75363628 |
| Molecular Formula | C14H9Cl2NO5S2 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 404.93 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(2,5-dichlorothiophen-3-yl)sulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H9Cl2NO5S2/c15-12-6-11(14(16)23-12)24(19,20)17-13(18)4-2-8-1-3-9-10(5-8)22-7-21-9/h1-6H,7H2,(H,17,18)/b4-2+ |
| InChIKey | DFFAZQGMYLPAHE-DUXPYHPUSA-N |
| XLogP | 3.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|