C15H13NO5S2 — CID 71894435
3-(1,3-benzodioxol-5-yl)-N-(5-methylthiophen-2-yl)sulfonylprop-2-enamide (PubChem CID 71894435) has the molecular formula C15H13NO5S2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(5-methylthiophen-2-yl)sulfonylprop-2-enamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(5-methylthiophen-2-yl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 71894435 |
| Molecular Formula | C15H13NO5S2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(5-methylthiophen-2-yl)sulfonylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C=Cc2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C15H13NO5S2/c1-10-2-7-15(22-10)23(18,19)16-14(17)6-4-11-3-5-12-13(8-11)21-9-20-12/h2-8H,9H2,1H3,(H,16,17) |
| InChIKey | QMXWMTGWYIZPEA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|