About N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide
N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide (PubChem CID 9472746) has the molecular formula C16H14N2O5
and a molecular weight of 314.30 g/mol. Its IUPAC name is N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide.
Molecular Properties
| Compound Name | N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide |
| PubChem CID | 9472746 |
| Molecular Formula | C16H14N2O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14N2O5/c1-10-12(6-7-21-10)16(20)18-17-15(19)5-3-11-2-4-13-14(8-11)23-9-22-13/h2-8H,9H2,1H3,(H,17,19)(H,18,20)/b5-3+ |
| InChIKey | QJPOYVZMBYWZFK-HWKANZROSA-N |
| XLogP | 1.79 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide?
The IUPAC name of N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide (CID 9472746) is N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide.
What is the SMILES notation for N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide?
The canonical SMILES for N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide is Cc1occc1C(=O)NNC(=O)/C=C/c1ccc2c(c1)OCO2.
What is the InChIKey of N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide?
The InChIKey is QJPOYVZMBYWZFK-HWKANZROSA-N. The full InChI is InChI=1S/C16H14N2O5/c1-10-12(6-7-21-10)16(20)18-17-15(19)5-3-11-2-4-13-14(8-11)23-9-22-13/h2-8H,9H2,1H3,(H,17,19)(H,18,20)/b5-3+.
What are the key properties of N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide?
N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide has a molecular weight of 314.30 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-2-methylfuran-3-carbohydrazide is sourced from PubChem (CID 9472746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).