C20H20N2O4 — CID 1293525
2-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-N-propan-2-ylbenzamide (PubChem CID 1293525) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-N-propan-2-ylbenzamide.
| Compound Name | 2-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 1293525 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1ccccc1NC(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20N2O4/c1-13(2)21-20(24)15-5-3-4-6-16(15)22-19(23)10-8-14-7-9-17-18(11-14)26-12-25-17/h3-11,13H,12H2,1-2H3,(H,21,24)(H,22,23)/b10-8+ |
| InChIKey | WRGRHIGIBGOKBV-CSKARUKUSA-N |
| XLogP | 3.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|