C21H20N2O4 — CID 75616751
N-cyclopropyl-2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]benzamide (PubChem CID 75616751) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]benzamide.
| Compound Name | N-cyclopropyl-2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 75616751 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-cyclopropyl-2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]benzamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCCO2)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C21H20N2O4/c24-20(10-6-14-5-9-18-19(13-14)27-12-11-26-18)23-17-4-2-1-3-16(17)21(25)22-15-7-8-15/h1-6,9-10,13,15H,7-8,11-12H2,(H,22,25)(H,23,24) |
| InChIKey | KJONWOPAWUAMLY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|