C18H15NO6 — CID 4970883
2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]-5-hydroxybenzoic acid (PubChem CID 4970883) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]-5-hydroxybenzoic acid.
| Compound Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4970883 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoylamino]-5-hydroxybenzoic acid |
| SMILES | O=C(C=Cc1ccc2c(c1)OCCO2)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C18H15NO6/c20-12-3-4-14(13(10-12)18(22)23)19-17(21)6-2-11-1-5-15-16(9-11)25-8-7-24-15/h1-6,9-10,20H,7-8H2,(H,19,21)(H,22,23) |
| InChIKey | ZOOYHTDHGDASSJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|