C17H15NO5 — CID 89280749
5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methylphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 89280749) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methylphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methylphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 89280749 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 5-hydroxy-2-[[(E)-3-(4-hydroxy-3-methylphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1cc(/C=C/C(=O)Nc2ccc(O)cc2C(=O)O)ccc1O |
| InChI | InChI=1S/C17H15NO5/c1-10-8-11(2-6-15(10)20)3-7-16(21)18-14-5-4-12(19)9-13(14)17(22)23/h2-9,19-20H,1H3,(H,18,21)(H,22,23)/b7-3+ |
| InChIKey | BTPVANIPAHYAFI-XVNBXDOJSA-N |
| XLogP | 2.76 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|