C16H13NO7 — CID 10471876
2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-3,5-dihydroxybenzoic acid (PubChem CID 10471876) has the molecular formula C16H13NO7 and a molecular weight of 331.28 g/mol. Its IUPAC name is 2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-3,5-dihydroxybenzoic acid.
| Compound Name | 2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-3,5-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 10471876 |
| Molecular Formula | C16H13NO7 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 2-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino]-3,5-dihydroxybenzoic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)Nc1c(O)cc(O)cc1C(=O)O |
| InChI | InChI=1S/C16H13NO7/c18-9-6-10(16(23)24)15(13(21)7-9)17-14(22)4-2-8-1-3-11(19)12(20)5-8/h1-7,18-21H,(H,17,22)(H,23,24)/b4-2+ |
| InChIKey | MCISILZJOPUTBR-DUXPYHPUSA-N |
| XLogP | 1.86 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|