C16H13NO8 — CID 10247081
4,5-dihydroxy-2-[[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 10247081) has the molecular formula C16H13NO8 and a molecular weight of 347.28 g/mol. Its IUPAC name is 4,5-dihydroxy-2-[[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4,5-dihydroxy-2-[[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10247081 |
| Molecular Formula | C16H13NO8 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4,5-dihydroxy-2-[[(E)-3-(3,4,5-trihydroxyphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1cc(O)c(O)c(O)c1)Nc1cc(O)c(O)cc1C(=O)O |
| InChI | InChI=1S/C16H13NO8/c18-10-5-8(16(24)25)9(6-11(10)19)17-14(22)2-1-7-3-12(20)15(23)13(21)4-7/h1-6,18-21,23H,(H,17,22)(H,24,25)/b2-1+ |
| InChIKey | GYOUGNMOETWXCC-OWOJBTEDSA-N |
| XLogP | 1.56 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|