C22H16ClNO3 — CID 164612116
4-chloro-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 164612116) has the molecular formula C22H16ClNO3 and a molecular weight of 377.83 g/mol. Its IUPAC name is 4-chloro-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 164612116 |
| Molecular Formula | C22H16ClNO3 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-chloro-2-[[(E)-3-(4-phenylphenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)cc1)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C22H16ClNO3/c23-18-11-12-19(22(26)27)20(14-18)24-21(25)13-8-15-6-9-17(10-7-15)16-4-2-1-3-5-16/h1-14H,(H,24,25)(H,26,27)/b13-8+ |
| InChIKey | MHRDRACFSSVARK-MDWZMJQESA-N |
| XLogP | 5.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|