C22H15F2NO3 — CID 67343940
4-(2,4-difluorophenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid (PubChem CID 67343940) has the molecular formula C22H15F2NO3 and a molecular weight of 379.36 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-(2,4-difluorophenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 67343940 |
| Molecular Formula | C22H15F2NO3 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 4-(2,4-difluorophenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1ccccc1)Nc1cc(-c2ccc(F)cc2F)ccc1C(=O)O |
| InChI | InChI=1S/C22H15F2NO3/c23-16-8-10-17(19(24)13-16)15-7-9-18(22(27)28)20(12-15)25-21(26)11-6-14-4-2-1-3-5-14/h1-13H,(H,25,26)(H,27,28)/b11-6+ |
| InChIKey | YBZAZTJAXGUFNW-IZZDOVSWSA-N |
| XLogP | 4.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|