C20H13F2NO3 — CID 67343264
2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid (PubChem CID 67343264) has the molecular formula C20H13F2NO3 and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid.
| Compound Name | 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 67343264 |
| Molecular Formula | C20H13F2NO3 |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid |
| SMILES | O=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H13F2NO3/c21-14-7-9-15(17(22)11-14)19(24)23-18-10-13(6-8-16(18)20(25)26)12-4-2-1-3-5-12/h1-11H,(H,23,24)(H,25,26) |
| InChIKey | NYPNXAOMLMFLEL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |