2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid

C20H13F2NO3 — CID 67343264

IUPAC2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid
SMILESO=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1ccc(F)cc1F
InChIInChI=1S/C20H13F2NO3/c21-14-7-9-15(17(22)11-14)19(24)23-18-10-13(6-8-16(18)20(25)26)12-4-2-1-3-5-12/h1-11H,(H,23,24)(H,25,26)
InChIKeyNYPNXAOMLMFLEL-UHFFFAOYSA-N
MW353.32 g/mol
LogP4.58
Rot. Bonds4

About 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid

2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid (PubChem CID 67343264) has the molecular formula C20H13F2NO3 and a molecular weight of 353.32 g/mol. Its IUPAC name is 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid.

Molecular Properties

Compound Name2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid
PubChem CID67343264
Molecular FormulaC20H13F2NO3
Molecular Weight353.32 g/mol
Exact Mass353.09
IUPAC Name2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid
SMILESO=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1ccc(F)cc1F
InChIInChI=1S/C20H13F2NO3/c21-14-7-9-15(17(22)11-14)19(24)23-18-10-13(6-8-16(18)20(25)26)12-4-2-1-3-5-12/h1-11H,(H,23,24)(H,25,26)
InChIKeyNYPNXAOMLMFLEL-UHFFFAOYSA-N
XLogP4.58
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.32
LogP ≤ 54.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid?
The IUPAC name of 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid (CID 67343264) is 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid.
What is the SMILES notation for 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid?
The canonical SMILES for 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid is O=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1ccc(F)cc1F.
What is the InChIKey of 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid?
The InChIKey is NYPNXAOMLMFLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F2NO3/c21-14-7-9-15(17(22)11-14)19(24)23-18-10-13(6-8-16(18)20(25)26)12-4-2-1-3-5-12/h1-11H,(H,23,24)(H,25,26).
What are the key properties of 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid?
2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid has a molecular weight of 353.32 g/mol, XLogP of 4.58, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-difluorobenzoyl)amino]-4-phenylbenzoic acid is sourced from PubChem (CID 67343264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).