C21H15NO5 — CID 167346908
2-[(2-carboxybenzoyl)amino]-4-phenylbenzoic acid (PubChem CID 167346908) has the molecular formula C21H15NO5 and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-[(2-carboxybenzoyl)amino]-4-phenylbenzoic acid.
| Compound Name | 2-[(2-carboxybenzoyl)amino]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 167346908 |
| Molecular Formula | C21H15NO5 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[(2-carboxybenzoyl)amino]-4-phenylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1NC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C21H15NO5/c23-19(15-8-4-5-9-16(15)20(24)25)22-18-12-14(10-11-17(18)21(26)27)13-6-2-1-3-7-13/h1-12H,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | XZXAVMTYOBQHDK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |