C21H14F3NO3 — CID 67344510
4-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid (PubChem CID 67344510) has the molecular formula C21H14F3NO3 and a molecular weight of 385.34 g/mol. Its IUPAC name is 4-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid.
| Compound Name | 4-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 67344510 |
| Molecular Formula | C21H14F3NO3 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 4-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F3NO3/c22-21(23,24)16-8-4-7-15(11-16)19(26)25-18-12-14(9-10-17(18)20(27)28)13-5-2-1-3-6-13/h1-12H,(H,25,26)(H,27,28) |
| InChIKey | CTYFKDPUGYWTIH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |