C23H16F3NO3 — CID 175255475
4-(2-phenylethenyl)-2-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid (PubChem CID 175255475) has the molecular formula C23H16F3NO3 and a molecular weight of 411.38 g/mol. Its IUPAC name is 4-(2-phenylethenyl)-2-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid.
| Compound Name | 4-(2-phenylethenyl)-2-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 175255475 |
| Molecular Formula | C23H16F3NO3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 4-(2-phenylethenyl)-2-[[3-(trifluoromethyl)benzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1cc(C=Cc2ccccc2)ccc1C(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H16F3NO3/c24-23(25,26)18-8-4-7-17(14-18)21(28)27-20-13-16(11-12-19(20)22(29)30)10-9-15-5-2-1-3-6-15/h1-14H,(H,27,28)(H,29,30) |
| InChIKey | AZXNFSFGWGJZNA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|