C22H17N3O3S — CID 68913921
2-benzamido-4-[2-(1H-2,1,3-benzothiadiazol-3-yl)ethenyl]benzoic acid (PubChem CID 68913921) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is 2-benzamido-4-[2-(1H-2,1,3-benzothiadiazol-3-yl)ethenyl]benzoic acid.
| Compound Name | 2-benzamido-4-[2-(1H-2,1,3-benzothiadiazol-3-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 68913921 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 2-benzamido-4-[2-(1H-2,1,3-benzothiadiazol-3-yl)ethenyl]benzoic acid |
| SMILES | O=C(Nc1cc(C=CN2SNc3ccccc32)ccc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O3S/c26-21(16-6-2-1-3-7-16)23-19-14-15(10-11-17(19)22(27)28)12-13-25-20-9-5-4-8-18(20)24-29-25/h1-14,24H,(H,23,26)(H,27,28) |
| InChIKey | CXBPKKPGVIHRLJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|